About ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate
ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate (PubChem CID 143065861) has the molecular formula C22H25NO3
and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate |
| PubChem CID | 143065861 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C2c3ccccc3COc3ccccc32)CC1 |
| InChI | InChI=1S/C22H25NO3/c1-2-25-22(24)23-13-11-16(12-14-23)21-18-8-4-3-7-17(18)15-26-20-10-6-5-9-19(20)21/h3-10,16,21H,2,11-15H2,1H3 |
| InChIKey | DQDINFGLBFNOLX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate?
The IUPAC name of ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate (CID 143065861) is ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate is CCOC(=O)N1CCC(C2c3ccccc3COc3ccccc32)CC1.
What is the InChIKey of ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate?
The InChIKey is DQDINFGLBFNOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO3/c1-2-25-22(24)23-13-11-16(12-14-23)21-18-8-4-3-7-17(18)15-26-20-10-6-5-9-19(20)21/h3-10,16,21H,2,11-15H2,1H3.
What are the key properties of ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate?
ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate has a molecular weight of 351.45 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidine-1-carboxylate is sourced from PubChem (CID 143065861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).