C12H15NO3 — CID 61068779
ethyl 3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (PubChem CID 61068779) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
| Compound Name | ethyl 3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
|---|---|
| PubChem CID | 61068779 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl 3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| SMILES | CCOC(=O)N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C12H15NO3/c1-2-15-12(14)13-7-8-16-11-6-4-3-5-10(11)9-13/h3-6H,2,7-9H2,1H3 |
| InChIKey | IDVOJBDHFMQPDM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |