C10H14N4O — CID 77054123
N'-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboximidamide (PubChem CID 77054123) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is N'-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboximidamide.
| Compound Name | N'-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboximidamide |
|---|---|
| PubChem CID | 77054123 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N'-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboximidamide |
| SMILES | NN=C(N)N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C10H14N4O/c11-10(13-12)14-5-6-15-9-4-2-1-3-8(9)7-14/h1-4H,5-7,12H2,(H2,11,13) |
| InChIKey | DMDIPYFXHBWVCX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|