C21H24N2O2 — CID 40515300
ethyl 4-(9H-fluoren-9-ylamino)piperidine-1-carboxylate (PubChem CID 40515300) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 4-(9H-fluoren-9-ylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(9H-fluoren-9-ylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 40515300 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl 4-(9H-fluoren-9-ylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C21H24N2O2/c1-2-25-21(24)23-13-11-15(12-14-23)22-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h3-10,15,20,22H,2,11-14H2,1H3 |
| InChIKey | NUSMMSOYRFEEAI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |