C28H36N2O4S — CID 59641788
[[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-1-yl]propanoate (PubChem CID 59641788) has the molecular formula C28H36N2O4S and a molecular weight of 496.67 g/mol. Its IUPAC name is [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-1-yl]propanoate.
| Compound Name | [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 59641788 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-1-yl]propanoate |
| SMILES | CCCC(=O)[C@H](CS)NOC(=O)CCN1CCC(C2c3ccccc3COc3ccccc32)CC1 |
| InChI | InChI=1S/C28H36N2O4S/c1-2-7-25(31)24(19-35)29-34-27(32)14-17-30-15-12-20(13-16-30)28-22-9-4-3-8-21(22)18-33-26-11-6-5-10-23(26)28/h3-6,8-11,20,24,28-29,35H,2,7,12-19H2,1H3/t24-,28?/m0/s1 |
| InChIKey | UQUITJUBYAFUMU-ZZDYIDRTSA-N |
| XLogP | 4.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|