About N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide
N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide (PubChem CID 125463978) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide.
Molecular Properties
| Compound Name | N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide |
| PubChem CID | 125463978 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide |
| SMILES | CC(=O)N[C@H]1c2ccccc2COc2ccccc21 |
| InChI | InChI=1S/C16H15NO2/c1-11(18)17-16-13-7-3-2-6-12(13)10-19-15-9-5-4-8-14(15)16/h2-9,16H,10H2,1H3,(H,17,18)/t16-/m0/s1 |
| InChIKey | RXTFUUMHUUWLTB-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide?
The IUPAC name of N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide (CID 125463978) is N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide.
What is the SMILES notation for N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide?
The canonical SMILES for N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide is CC(=O)N[C@H]1c2ccccc2COc2ccccc21.
What is the InChIKey of N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide?
The InChIKey is RXTFUUMHUUWLTB-INIZCTEOSA-N. The full InChI is InChI=1S/C16H15NO2/c1-11(18)17-16-13-7-3-2-6-12(13)10-19-15-9-5-4-8-14(15)16/h2-9,16H,10H2,1H3,(H,17,18)/t16-/m0/s1.
What are the key properties of N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide?
N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide has a molecular weight of 253.30 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(11S)-6,11-dihydrobenzo[c][1]benzoxepin-11-yl]acetamide is sourced from PubChem (CID 125463978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).