C27H36N2O3S — CID 59641783
[[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-(4-benzhydrylpiperidin-1-yl)propanoate (PubChem CID 59641783) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-(4-benzhydrylpiperidin-1-yl)propanoate.
| Compound Name | [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-(4-benzhydrylpiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 59641783 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [[(2R)-3-oxo-1-sulfanylhexan-2-yl]amino] 3-(4-benzhydrylpiperidin-1-yl)propanoate |
| SMILES | CCCC(=O)[C@H](CS)NOC(=O)CCN1CCC(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2O3S/c1-2-9-25(30)24(20-33)28-32-26(31)16-19-29-17-14-23(15-18-29)27(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-8,10-13,23-24,27-28,33H,2,9,14-20H2,1H3/t24-/m0/s1 |
| InChIKey | VMBSDLWWTYCWOB-DEOSSOPVSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|