C32H37NO4 — CID 139808124
4-[4-[(4-hydroxyphenyl)-phenylmethyl]piperidin-1-yl]butanoyl 2-methyl-2-phenylpropanoate (PubChem CID 139808124) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is 4-[4-[(4-hydroxyphenyl)-phenylmethyl]piperidin-1-yl]butanoyl 2-methyl-2-phenylpropanoate.
| Compound Name | 4-[4-[(4-hydroxyphenyl)-phenylmethyl]piperidin-1-yl]butanoyl 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 139808124 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 4-[4-[(4-hydroxyphenyl)-phenylmethyl]piperidin-1-yl]butanoyl 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OC(=O)CCCN1CCC(C(c2ccccc2)c2ccc(O)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H37NO4/c1-32(2,27-12-7-4-8-13-27)31(36)37-29(35)14-9-21-33-22-19-26(20-23-33)30(24-10-5-3-6-11-24)25-15-17-28(34)18-16-25/h3-8,10-13,15-18,26,30,34H,9,14,19-23H2,1-2H3 |
| InChIKey | OTYYBFNCXCQAHA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|