C20H19F3N2O2 — CID 110400062
[4-(3,4-dihydro-2H-chromen-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 110400062) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-chromen-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(3,4-dihydro-2H-chromen-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110400062 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [4-(3,4-dihydro-2H-chromen-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCN(C2CCOc3ccccc32)CC1 |
| InChI | InChI=1S/C20H19F3N2O2/c21-15-6-5-14(18(22)19(15)23)20(26)25-10-8-24(9-11-25)16-7-12-27-17-4-2-1-3-13(16)17/h1-6,16H,7-12H2 |
| InChIKey | HPKWNIJOPKWXAS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|