C30H52O2 — CID 123233064
1-[3,3-dimethyl-1-(2,4,6-trimethylcyclohexyl)oxybutoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene (PubChem CID 123233064) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1-(2,4,6-trimethylcyclohexyl)oxybutoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene.
| Compound Name | 1-[3,3-dimethyl-1-(2,4,6-trimethylcyclohexyl)oxybutoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123233064 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | 1-[3,3-dimethyl-1-(2,4,6-trimethylcyclohexyl)oxybutoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
| SMILES | CC(C)CC(c1ccc(OC(CC(C)(C)C)OC2C(C)CC(C)CC2C)cc1)C(C)(C)C |
| InChI | InChI=1S/C30H52O2/c1-20(2)16-26(30(9,10)11)24-12-14-25(15-13-24)31-27(19-29(6,7)8)32-28-22(4)17-21(3)18-23(28)5/h12-15,20-23,26-28H,16-19H2,1-11H3 |
| InChIKey | XSQICAGSWGWIRT-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|