C37H70O2 — CID 144561073
1-[1-(4-butyl-2-methylcyclohexyl)oxy-3,3-dimethylpentoxy]-4-(2,2-dimethylhexan-3-yl)benzene;ethane;propane (PubChem CID 144561073) has the molecular formula C37H70O2 and a molecular weight of 546.97 g/mol. Its IUPAC name is 1-[1-(4-butyl-2-methylcyclohexyl)oxy-3,3-dimethylpentoxy]-4-(2,2-dimethylhexan-3-yl)benzene;ethane;propane.
| Compound Name | 1-[1-(4-butyl-2-methylcyclohexyl)oxy-3,3-dimethylpentoxy]-4-(2,2-dimethylhexan-3-yl)benzene;ethane;propane |
|---|---|
| PubChem CID | 144561073 |
| Molecular Formula | C37H70O2 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.54 |
| IUPAC Name | 1-[1-(4-butyl-2-methylcyclohexyl)oxy-3,3-dimethylpentoxy]-4-(2,2-dimethylhexan-3-yl)benzene;ethane;propane |
| SMILES | CC.CCC.CCCCC1CCC(OC(CC(C)(C)CC)Oc2ccc(C(CCC)C(C)(C)C)cc2)C(C)C1 |
| InChI | InChI=1S/C32H56O2.C3H8.C2H6/c1-10-13-15-25-16-21-29(24(4)22-25)34-30(23-32(8,9)12-3)33-27-19-17-26(18-20-27)28(14-11-2)31(5,6)7;1-3-2;1-2/h17-20,24-25,28-30H,10-16,21-23H2,1-9H3;3H2,1-2H3;1-2H3 |
| InChIKey | YYRBIPOTVRGYKQ-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|