C22H36O2 — CID 170202704
1-(3-methylbutan-2-yl)-4-[1-[(4-methylcyclohexyl)methoxy]propoxy]benzene (PubChem CID 170202704) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-(3-methylbutan-2-yl)-4-[1-[(4-methylcyclohexyl)methoxy]propoxy]benzene.
| Compound Name | 1-(3-methylbutan-2-yl)-4-[1-[(4-methylcyclohexyl)methoxy]propoxy]benzene |
|---|---|
| PubChem CID | 170202704 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-(3-methylbutan-2-yl)-4-[1-[(4-methylcyclohexyl)methoxy]propoxy]benzene |
| SMILES | CCC(OCC1CCC(C)CC1)Oc1ccc(C(C)C(C)C)cc1 |
| InChI | InChI=1S/C22H36O2/c1-6-22(23-15-19-9-7-17(4)8-10-19)24-21-13-11-20(12-14-21)18(5)16(2)3/h11-14,16-19,22H,6-10,15H2,1-5H3 |
| InChIKey | NIFZBHIVXUJONU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|