C20H34O2 — CID 123693664
1-(2,6-dimethylheptan-4-yl)-4-(1-ethoxypropoxy)benzene (PubChem CID 123693664) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-(2,6-dimethylheptan-4-yl)-4-(1-ethoxypropoxy)benzene.
| Compound Name | 1-(2,6-dimethylheptan-4-yl)-4-(1-ethoxypropoxy)benzene |
|---|---|
| PubChem CID | 123693664 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-(2,6-dimethylheptan-4-yl)-4-(1-ethoxypropoxy)benzene |
| SMILES | CCOC(CC)Oc1ccc(C(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C20H34O2/c1-7-20(21-8-2)22-19-11-9-17(10-12-19)18(13-15(3)4)14-16(5)6/h9-12,15-16,18,20H,7-8,13-14H2,1-6H3 |
| InChIKey | KGIDHHCTAMZJRN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|