C19H28O2 — CID 88872565
1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-(1-ethoxypropoxy)benzene (PubChem CID 88872565) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-(1-ethoxypropoxy)benzene.
| Compound Name | 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-(1-ethoxypropoxy)benzene |
|---|---|
| PubChem CID | 88872565 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-(1-ethoxypropoxy)benzene |
| SMILES | CCOC(CC)Oc1ccc(C(C=C(C)C)=C(C)C)cc1 |
| InChI | InChI=1S/C19H28O2/c1-7-19(20-8-2)21-17-11-9-16(10-12-17)18(15(5)6)13-14(3)4/h9-13,19H,7-8H2,1-6H3 |
| InChIKey | LXLGWJFFTULTMS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|