C23H27NO2 — CID 70612926
(Z)-2-[4-(1-ethoxyhexoxy)phenyl]-3-phenylprop-2-enenitrile (PubChem CID 70612926) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (Z)-2-[4-(1-ethoxyhexoxy)phenyl]-3-phenylprop-2-enenitrile.
| Compound Name | (Z)-2-[4-(1-ethoxyhexoxy)phenyl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 70612926 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (Z)-2-[4-(1-ethoxyhexoxy)phenyl]-3-phenylprop-2-enenitrile |
| SMILES | CCCCCC(OCC)Oc1ccc(/C(C#N)=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO2/c1-3-5-7-12-23(25-4-2)26-22-15-13-20(14-16-22)21(18-24)17-19-10-8-6-9-11-19/h6,8-11,13-17,23H,3-5,7,12H2,1-2H3/b21-17+ |
| InChIKey | QNVLNCFGKCLLQN-HEHNFIMWSA-N |
| XLogP | 6.07 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|