About 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate
1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate (PubChem CID 89415638) has the molecular formula C31H37NO5
and a molecular weight of 503.64 g/mol. Its IUPAC name is 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate |
| PubChem CID | 89415638 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCCCCCC)Oc1ccc(/C=C(\C#N)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C31H37NO5/c1-4-5-6-7-8-9-10-11-12-30(37-31(33)23(2)3)36-27-16-13-24(14-17-27)19-26(21-32)25-15-18-28-29(20-25)35-22-34-28/h13-20,30H,2,4-12,22H2,1,3H3/b26-19+ |
| InChIKey | VGBOBGXKHXVDPT-LGUFXXKBSA-N |
| XLogP | 7.83 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate?
The IUPAC name of 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate (CID 89415638) is 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate.
What is the SMILES notation for 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate?
The canonical SMILES for 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate is C=C(C)C(=O)OC(CCCCCCCCCC)Oc1ccc(/C=C(\C#N)c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate?
The InChIKey is VGBOBGXKHXVDPT-LGUFXXKBSA-N. The full InChI is InChI=1S/C31H37NO5/c1-4-5-6-7-8-9-10-11-12-30(37-31(33)23(2)3)36-27-16-13-24(14-17-27)19-26(21-32)25-15-18-28-29(20-25)35-22-34-28/h13-20,30H,2,4-12,22H2,1,3H3/b26-19+.
What are the key properties of 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate?
1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate has a molecular weight of 503.64 g/mol, XLogP of 7.83, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate is sourced from PubChem (CID 89415638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).