C31H37NO5 — CID 89415638
1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate (PubChem CID 89415638) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89415638 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-2-cyanoethenyl]phenoxy]undecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCCCCCC)Oc1ccc(/C=C(\C#N)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C31H37NO5/c1-4-5-6-7-8-9-10-11-12-30(37-31(33)23(2)3)36-27-16-13-24(14-17-27)19-26(21-32)25-15-18-28-29(20-25)35-22-34-28/h13-20,30H,2,4-12,22H2,1,3H3/b26-19+ |
| InChIKey | VGBOBGXKHXVDPT-LGUFXXKBSA-N |
| XLogP | 7.83 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|