C32H39NO6 — CID 89415604
1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-1-cyanoethenyl]-2-methoxyphenoxy]undecyl 2-methylprop-2-enoate (PubChem CID 89415604) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-1-cyanoethenyl]-2-methoxyphenoxy]undecyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-1-cyanoethenyl]-2-methoxyphenoxy]undecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89415604 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1-[4-[(Z)-2-(1,3-benzodioxol-5-yl)-1-cyanoethenyl]-2-methoxyphenoxy]undecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCCCCCC)Oc1ccc(/C(C#N)=C/c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C32H39NO6/c1-5-6-7-8-9-10-11-12-13-31(39-32(34)23(2)3)38-28-17-15-25(20-29(28)35-4)26(21-33)18-24-14-16-27-30(19-24)37-22-36-27/h14-20,31H,2,5-13,22H2,1,3-4H3/b26-18+ |
| InChIKey | ZDKXRLLBAIBFLD-NLRVBDNBSA-N |
| XLogP | 7.84 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|