C88H144N2O4 — CID 177431792
(Z)-3-[2,4-bis(2-hexyldecoxy)phenyl]-2-[4-[(Z)-2-[2,4-bis(2-hexyldecoxy)phenyl]-1-cyanoethenyl]phenyl]prop-2-enenitrile (PubChem CID 177431792) has the molecular formula C88H144N2O4 and a molecular weight of 1294.13 g/mol. Its IUPAC name is (Z)-3-[2,4-bis(2-hexyldecoxy)phenyl]-2-[4-[(Z)-2-[2,4-bis(2-hexyldecoxy)phenyl]-1-cyanoethenyl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[2,4-bis(2-hexyldecoxy)phenyl]-2-[4-[(Z)-2-[2,4-bis(2-hexyldecoxy)phenyl]-1-cyanoethenyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 177431792 |
| Molecular Formula | C88H144N2O4 |
| Molecular Weight | 1294.13 g/mol |
| Exact Mass | 1293.11 |
| IUPAC Name | (Z)-3-[2,4-bis(2-hexyldecoxy)phenyl]-2-[4-[(Z)-2-[2,4-bis(2-hexyldecoxy)phenyl]-1-cyanoethenyl]phenyl]prop-2-enenitrile |
| SMILES | CCCCCCCCC(CCCCCC)COc1ccc(/C=C(\C#N)c2ccc(/C(C#N)=C/c3ccc(OCC(CCCCCC)CCCCCCCC)cc3OCC(CCCCCC)CCCCCCCC)cc2)c(OCC(CCCCCC)CCCCCCCC)c1 |
| InChI | InChI=1S/C88H144N2O4/c1-9-17-25-33-37-45-53-75(49-41-29-21-13-5)71-91-85-63-61-81(87(67-85)93-73-77(51-43-31-23-15-7)55-47-39-35-27-19-11-3)65-83(69-89)79-57-59-80(60-58-79)84(70-90)66-82-62-64-86(92-72-76(50-42-30-22-14-6)54-46-38-34-26-18-10-2)68-88(82)94-74-78(52-44-32-24-16-8)56-48-40-36-28-20-12-4/h57-68,75-78H,9-56,71-74H2,1-8H3/b83-65+,84-66+ |
| InChIKey | HZDMNFQRKUMUHM-QLCPVWBESA-N |
| XLogP | 28.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1294.13 |
| LogP ≤ 5 | 28.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|