C64H88N2O6 — CID 102384877
(Z)-2-[4-[6-[4-[(Z)-1-cyano-2-(2,5-diheptoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-3-(2,5-diheptoxyphenyl)prop-2-enenitrile (PubChem CID 102384877) has the molecular formula C64H88N2O6 and a molecular weight of 981.42 g/mol. Its IUPAC name is (Z)-2-[4-[6-[4-[(Z)-1-cyano-2-(2,5-diheptoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-3-(2,5-diheptoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-[6-[4-[(Z)-1-cyano-2-(2,5-diheptoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-3-(2,5-diheptoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 102384877 |
| Molecular Formula | C64H88N2O6 |
| Molecular Weight | 981.42 g/mol |
| Exact Mass | 980.66 |
| IUPAC Name | (Z)-2-[4-[6-[4-[(Z)-1-cyano-2-(2,5-diheptoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-3-(2,5-diheptoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCCCOc1ccc(OCCCCCCC)c(/C=C(\C#N)c2ccc(OCCCCCCOc3ccc(/C(C#N)=C/c4cc(OCCCCCCC)ccc4OCCCCCCC)cc3)cc2)c1 |
| InChI | InChI=1S/C64H88N2O6/c1-5-9-13-17-23-43-69-61-37-39-63(71-45-27-19-15-11-7-3)55(49-61)47-57(51-65)53-29-33-59(34-30-53)67-41-25-21-22-26-42-68-60-35-31-54(32-36-60)58(52-66)48-56-50-62(70-44-24-18-14-10-6-2)38-40-64(56)72-46-28-20-16-12-8-4/h29-40,47-50H,5-28,41-46H2,1-4H3/b57-47+,58-48+ |
| InChIKey | JNANIUMFULNOGA-MDOPCFPLSA-N |
| XLogP | 18.23 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.42 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|