C24H25NO2 — CID 175516278
[4-(1-cyano-2-phenylethenyl)phenyl] 2-methylideneoctanoate (PubChem CID 175516278) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is [4-(1-cyano-2-phenylethenyl)phenyl] 2-methylideneoctanoate.
| Compound Name | [4-(1-cyano-2-phenylethenyl)phenyl] 2-methylideneoctanoate |
|---|---|
| PubChem CID | 175516278 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | [4-(1-cyano-2-phenylethenyl)phenyl] 2-methylideneoctanoate |
| SMILES | C=C(CCCCCC)C(=O)Oc1ccc(C(C#N)=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO2/c1-3-4-5-7-10-19(2)24(26)27-23-15-13-21(14-16-23)22(18-25)17-20-11-8-6-9-12-20/h6,8-9,11-17H,2-5,7,10H2,1H3 |
| InChIKey | OGRGYUPNRPXBFA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|