C52H52N2O2 — CID 101126957
(Z)-2-[4-[(Z)-1-cyano-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-2,5-dihexoxyphenyl]-3-[4-[(E)-2-phenylethenyl]phenyl]prop-2-enenitrile (PubChem CID 101126957) has the molecular formula C52H52N2O2 and a molecular weight of 737.00 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-2,5-dihexoxyphenyl]-3-[4-[(E)-2-phenylethenyl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-2,5-dihexoxyphenyl]-3-[4-[(E)-2-phenylethenyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 101126957 |
| Molecular Formula | C52H52N2O2 |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-2,5-dihexoxyphenyl]-3-[4-[(E)-2-phenylethenyl]phenyl]prop-2-enenitrile |
| SMILES | CCCCCCOc1cc(/C(C#N)=C/c2ccc(/C=C/c3ccccc3)cc2)c(OCCCCCC)cc1/C(C#N)=C/c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C52H52N2O2/c1-3-5-7-15-33-55-51-37-50(48(40-54)36-46-31-27-44(28-32-46)24-22-42-19-13-10-14-20-42)52(56-34-16-8-6-4-2)38-49(51)47(39-53)35-45-29-25-43(26-30-45)23-21-41-17-11-9-12-18-41/h9-14,17-32,35-38H,3-8,15-16,33-34H2,1-2H3/b23-21+,24-22+,47-35+,48-36+ |
| InChIKey | ROWAYEDEAQMAHK-QTQXQABDSA-N |
| XLogP | 14.07 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|