C20H30O2 — CID 88872450
1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-[1-(2-methylpropoxy)ethoxy]benzene (PubChem CID 88872450) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-[1-(2-methylpropoxy)ethoxy]benzene.
| Compound Name | 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-[1-(2-methylpropoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 88872450 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-(2,5-dimethylhexa-2,4-dien-3-yl)-4-[1-(2-methylpropoxy)ethoxy]benzene |
| SMILES | CC(C)=CC(=C(C)C)c1ccc(OC(C)OCC(C)C)cc1 |
| InChI | InChI=1S/C20H30O2/c1-14(2)12-20(16(5)6)18-8-10-19(11-9-18)22-17(7)21-13-15(3)4/h8-12,15,17H,13H2,1-7H3 |
| InChIKey | BLHPYZFVFSWPJP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|