C19H32O2 — CID 123503822
1-(2,5-dimethylheptan-4-yl)-4-(1-ethoxyethoxy)benzene (PubChem CID 123503822) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-(2,5-dimethylheptan-4-yl)-4-(1-ethoxyethoxy)benzene.
| Compound Name | 1-(2,5-dimethylheptan-4-yl)-4-(1-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 123503822 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-(2,5-dimethylheptan-4-yl)-4-(1-ethoxyethoxy)benzene |
| SMILES | CCOC(C)Oc1ccc(C(CC(C)C)C(C)CC)cc1 |
| InChI | InChI=1S/C19H32O2/c1-7-15(5)19(13-14(3)4)17-9-11-18(12-10-17)21-16(6)20-8-2/h9-12,14-16,19H,7-8,13H2,1-6H3 |
| InChIKey | AFPNKMATRCOBHA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|