C32H42O6 — CID 22726285
1-[1,1-bis[4-(1-ethoxyethoxy)phenyl]ethyl]-4-(1-ethoxyethoxy)benzene (PubChem CID 22726285) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is 1-[1,1-bis[4-(1-ethoxyethoxy)phenyl]ethyl]-4-(1-ethoxyethoxy)benzene.
| Compound Name | 1-[1,1-bis[4-(1-ethoxyethoxy)phenyl]ethyl]-4-(1-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 22726285 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 1-[1,1-bis[4-(1-ethoxyethoxy)phenyl]ethyl]-4-(1-ethoxyethoxy)benzene |
| SMILES | CCOC(C)Oc1ccc(C(C)(c2ccc(OC(C)OCC)cc2)c2ccc(OC(C)OCC)cc2)cc1 |
| InChI | InChI=1S/C32H42O6/c1-8-33-23(4)36-29-17-11-26(12-18-29)32(7,27-13-19-30(20-14-27)37-24(5)34-9-2)28-15-21-31(22-16-28)38-25(6)35-10-3/h11-25H,8-10H2,1-7H3 |
| InChIKey | QTHBXNOIPNZQCL-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|