C42H66O6 — CID 162232854
1-butan-2-yl-4-(1-ethoxyethoxy)benzene;1-butan-2-yl-4-(ethoxymethoxy)benzene;1-(1-ethoxyethoxy)-4-(2-methylbutan-2-yl)benzene (PubChem CID 162232854) has the molecular formula C42H66O6 and a molecular weight of 666.98 g/mol. Its IUPAC name is 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;1-butan-2-yl-4-(ethoxymethoxy)benzene;1-(1-ethoxyethoxy)-4-(2-methylbutan-2-yl)benzene.
| Compound Name | 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;1-butan-2-yl-4-(ethoxymethoxy)benzene;1-(1-ethoxyethoxy)-4-(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 162232854 |
| Molecular Formula | C42H66O6 |
| Molecular Weight | 666.98 g/mol |
| Exact Mass | 666.49 |
| IUPAC Name | 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;1-butan-2-yl-4-(ethoxymethoxy)benzene;1-(1-ethoxyethoxy)-4-(2-methylbutan-2-yl)benzene |
| SMILES | CCOC(C)Oc1ccc(C(C)(C)CC)cc1.CCOC(C)Oc1ccc(C(C)CC)cc1.CCOCOc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C15H24O2.C14H22O2.C13H20O2/c1-6-15(4,5)13-8-10-14(11-9-13)17-12(3)16-7-2;1-5-11(3)13-7-9-14(10-8-13)16-12(4)15-6-2;1-4-11(3)12-6-8-13(9-7-12)15-10-14-5-2/h8-12H,6-7H2,1-5H3;7-12H,5-6H2,1-4H3;6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | ZVQWFPIJTLLIHL-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.98 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|