C16H21F5O2 — CID 20756247
1-(2-methylbutan-2-yl)-4-[1-(2,2,3,3,3-pentafluoropropoxy)ethoxy]benzene (PubChem CID 20756247) has the molecular formula C16H21F5O2 and a molecular weight of 340.33 g/mol. Its IUPAC name is 1-(2-methylbutan-2-yl)-4-[1-(2,2,3,3,3-pentafluoropropoxy)ethoxy]benzene.
| Compound Name | 1-(2-methylbutan-2-yl)-4-[1-(2,2,3,3,3-pentafluoropropoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 20756247 |
| Molecular Formula | C16H21F5O2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(2-methylbutan-2-yl)-4-[1-(2,2,3,3,3-pentafluoropropoxy)ethoxy]benzene |
| SMILES | CCC(C)(C)c1ccc(OC(C)OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F5O2/c1-5-14(3,4)12-6-8-13(9-7-12)23-11(2)22-10-15(17,18)16(19,20)21/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | KBXHYCNDYLSQSQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|