C44H58O9 — CID 139547150
1-[2-[2,2-bis(1-phenoxyethoxymethyl)butoxymethyl]-2-(1-phenoxyethoxymethyl)butoxy]ethoxybenzene (PubChem CID 139547150) has the molecular formula C44H58O9 and a molecular weight of 730.94 g/mol. Its IUPAC name is 1-[2-[2,2-bis(1-phenoxyethoxymethyl)butoxymethyl]-2-(1-phenoxyethoxymethyl)butoxy]ethoxybenzene.
| Compound Name | 1-[2-[2,2-bis(1-phenoxyethoxymethyl)butoxymethyl]-2-(1-phenoxyethoxymethyl)butoxy]ethoxybenzene |
|---|---|
| PubChem CID | 139547150 |
| Molecular Formula | C44H58O9 |
| Molecular Weight | 730.94 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | 1-[2-[2,2-bis(1-phenoxyethoxymethyl)butoxymethyl]-2-(1-phenoxyethoxymethyl)butoxy]ethoxybenzene |
| SMILES | CCC(COCC(CC)(COC(C)Oc1ccccc1)COC(C)Oc1ccccc1)(COC(C)Oc1ccccc1)COC(C)Oc1ccccc1 |
| InChI | InChI=1S/C44H58O9/c1-7-43(31-46-35(3)50-39-21-13-9-14-22-39,32-47-36(4)51-40-23-15-10-16-24-40)29-45-30-44(8-2,33-48-37(5)52-41-25-17-11-18-26-41)34-49-38(6)53-42-27-19-12-20-28-42/h9-28,35-38H,7-8,29-34H2,1-6H3 |
| InChIKey | QKYFYCDTSTWEAE-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.94 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|