About 1-methoxyethoxybenzene
1-methoxyethoxybenzene (PubChem CID 18188895) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-methoxyethoxybenzene.
Molecular Properties
| Compound Name | 1-methoxyethoxybenzene |
| PubChem CID | 18188895 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1-methoxyethoxybenzene |
| SMILES | COC(C)Oc1ccccc1 |
| InChI | InChI=1S/C9H12O2/c1-8(10-2)11-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | DSUIDSZRTNMKTA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethoxybenzene?
The IUPAC name of 1-methoxyethoxybenzene (CID 18188895) is 1-methoxyethoxybenzene.
What is the SMILES notation for 1-methoxyethoxybenzene?
The canonical SMILES for 1-methoxyethoxybenzene is COC(C)Oc1ccccc1.
What is the InChIKey of 1-methoxyethoxybenzene?
The InChIKey is DSUIDSZRTNMKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-8(10-2)11-9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of 1-methoxyethoxybenzene?
1-methoxyethoxybenzene has a molecular weight of 152.19 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethoxybenzene is sourced from PubChem (CID 18188895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).