About 1-phenoxyethanol
1-phenoxyethanol (PubChem CID 66611531) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-phenoxyethanol.
Molecular Properties
| Compound Name | 1-phenoxyethanol |
| PubChem CID | 66611531 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-phenoxyethanol |
| SMILES | CC(O)Oc1ccccc1.CC(O)Oc1ccccc1 |
| InChI | InChI=1S/2C8H10O2/c2*1-7(9)10-8-5-3-2-4-6-8/h2*2-7,9H,1H3 |
| InChIKey | RJURRZFUWSRXDY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyethanol?
The IUPAC name of 1-phenoxyethanol (CID 66611531) is 1-phenoxyethanol.
What is the SMILES notation for 1-phenoxyethanol?
The canonical SMILES for 1-phenoxyethanol is CC(O)Oc1ccccc1.CC(O)Oc1ccccc1.
What is the InChIKey of 1-phenoxyethanol?
The InChIKey is RJURRZFUWSRXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O2/c2*1-7(9)10-8-5-3-2-4-6-8/h2*2-7,9H,1H3.
What are the key properties of 1-phenoxyethanol?
1-phenoxyethanol has a molecular weight of 276.33 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyethanol is sourced from PubChem (CID 66611531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).