About chloroform;1-phenoxyethanol
chloroform;1-phenoxyethanol (PubChem CID 160851082) has the molecular formula C9H11Cl3O2
and a molecular weight of 257.54 g/mol. Its IUPAC name is chloroform;1-phenoxyethanol.
Molecular Properties
| Compound Name | chloroform;1-phenoxyethanol |
| PubChem CID | 160851082 |
| Molecular Formula | C9H11Cl3O2 |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | chloroform;1-phenoxyethanol |
| SMILES | CC(O)Oc1ccccc1.ClC(Cl)Cl |
| InChI | InChI=1S/C8H10O2.CHCl3/c1-7(9)10-8-5-3-2-4-6-8;2-1(3)4/h2-7,9H,1H3;1H |
| InChIKey | SJGRAMVYTAJSJB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze chloroform;1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;1-phenoxyethanol?
The IUPAC name of chloroform;1-phenoxyethanol (CID 160851082) is chloroform;1-phenoxyethanol.
What is the SMILES notation for chloroform;1-phenoxyethanol?
The canonical SMILES for chloroform;1-phenoxyethanol is CC(O)Oc1ccccc1.ClC(Cl)Cl.
What is the InChIKey of chloroform;1-phenoxyethanol?
The InChIKey is SJGRAMVYTAJSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.CHCl3/c1-7(9)10-8-5-3-2-4-6-8;2-1(3)4/h2-7,9H,1H3;1H.
What are the key properties of chloroform;1-phenoxyethanol?
chloroform;1-phenoxyethanol has a molecular weight of 257.54 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;1-phenoxyethanol is sourced from PubChem (CID 160851082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).