About magnesium;1-phenoxyethanol;sulfate
magnesium;1-phenoxyethanol;sulfate (PubChem CID 159781449) has the molecular formula C8H10MgO6S
and a molecular weight of 258.53 g/mol. Its IUPAC name is magnesium;1-phenoxyethanol;sulfate.
Molecular Properties
| Compound Name | magnesium;1-phenoxyethanol;sulfate |
| PubChem CID | 159781449 |
| Molecular Formula | C8H10MgO6S |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | magnesium;1-phenoxyethanol;sulfate |
| SMILES | CC(O)Oc1ccccc1.O=S(=O)([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C8H10O2.Mg.H2O4S/c1-7(9)10-8-5-3-2-4-6-8;;1-5(2,3)4/h2-7,9H,1H3;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | NHKHCOSPBRIMQM-UHFFFAOYSA-L |
| XLogP | -0.32 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-phenoxyethanol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-phenoxyethanol;sulfate?
The IUPAC name of magnesium;1-phenoxyethanol;sulfate (CID 159781449) is magnesium;1-phenoxyethanol;sulfate.
What is the SMILES notation for magnesium;1-phenoxyethanol;sulfate?
The canonical SMILES for magnesium;1-phenoxyethanol;sulfate is CC(O)Oc1ccccc1.O=S(=O)([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;1-phenoxyethanol;sulfate?
The InChIKey is NHKHCOSPBRIMQM-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10O2.Mg.H2O4S/c1-7(9)10-8-5-3-2-4-6-8;;1-5(2,3)4/h2-7,9H,1H3;;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of magnesium;1-phenoxyethanol;sulfate?
magnesium;1-phenoxyethanol;sulfate has a molecular weight of 258.53 g/mol, XLogP of -0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-phenoxyethanol;sulfate is sourced from PubChem (CID 159781449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).