About 1-phenoxyethanol;2-phenylethanol
1-phenoxyethanol;2-phenylethanol (PubChem CID 70376198) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 1-phenoxyethanol;2-phenylethanol.
Molecular Properties
| Compound Name | 1-phenoxyethanol;2-phenylethanol |
| PubChem CID | 70376198 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-phenoxyethanol;2-phenylethanol |
| SMILES | CC(O)Oc1ccccc1.OCCc1ccccc1 |
| InChI | InChI=1S/C8H10O2.C8H10O/c1-7(9)10-8-5-3-2-4-6-8;9-7-6-8-4-2-1-3-5-8/h2-7,9H,1H3;1-5,9H,6-7H2 |
| InChIKey | CZYPOGFSECPYHA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyethanol;2-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyethanol;2-phenylethanol?
The IUPAC name of 1-phenoxyethanol;2-phenylethanol (CID 70376198) is 1-phenoxyethanol;2-phenylethanol.
What is the SMILES notation for 1-phenoxyethanol;2-phenylethanol?
The canonical SMILES for 1-phenoxyethanol;2-phenylethanol is CC(O)Oc1ccccc1.OCCc1ccccc1.
What is the InChIKey of 1-phenoxyethanol;2-phenylethanol?
The InChIKey is CZYPOGFSECPYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C8H10O/c1-7(9)10-8-5-3-2-4-6-8;9-7-6-8-4-2-1-3-5-8/h2-7,9H,1H3;1-5,9H,6-7H2.
What are the key properties of 1-phenoxyethanol;2-phenylethanol?
1-phenoxyethanol;2-phenylethanol has a molecular weight of 260.33 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyethanol;2-phenylethanol is sourced from PubChem (CID 70376198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).