About 2-methylprop-2-enoic acid;1-phenoxyethanol
2-methylprop-2-enoic acid;1-phenoxyethanol (PubChem CID 67581727) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;1-phenoxyethanol.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;1-phenoxyethanol |
| PubChem CID | 67581727 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-methylprop-2-enoic acid;1-phenoxyethanol |
| SMILES | C=C(C)C(=O)O.CC(O)Oc1ccccc1 |
| InChI | InChI=1S/C8H10O2.C4H6O2/c1-7(9)10-8-5-3-2-4-6-8;1-3(2)4(5)6/h2-7,9H,1H3;1H2,2H3,(H,5,6) |
| InChIKey | NXYOKWKBTFNZRH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;1-phenoxyethanol?
The IUPAC name of 2-methylprop-2-enoic acid;1-phenoxyethanol (CID 67581727) is 2-methylprop-2-enoic acid;1-phenoxyethanol.
What is the SMILES notation for 2-methylprop-2-enoic acid;1-phenoxyethanol?
The canonical SMILES for 2-methylprop-2-enoic acid;1-phenoxyethanol is C=C(C)C(=O)O.CC(O)Oc1ccccc1.
What is the InChIKey of 2-methylprop-2-enoic acid;1-phenoxyethanol?
The InChIKey is NXYOKWKBTFNZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C4H6O2/c1-7(9)10-8-5-3-2-4-6-8;1-3(2)4(5)6/h2-7,9H,1H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;1-phenoxyethanol?
2-methylprop-2-enoic acid;1-phenoxyethanol has a molecular weight of 224.26 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;1-phenoxyethanol is sourced from PubChem (CID 67581727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).