About anisole;1-phenoxyethanol
anisole;1-phenoxyethanol (PubChem CID 143208941) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is anisole;1-phenoxyethanol.
Molecular Properties
| Compound Name | anisole;1-phenoxyethanol |
| PubChem CID | 143208941 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | anisole;1-phenoxyethanol |
| SMILES | CC(O)Oc1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/C8H10O2.C7H8O/c1-7(9)10-8-5-3-2-4-6-8;1-8-7-5-3-2-4-6-7/h2-7,9H,1H3;2-6H,1H3 |
| InChIKey | LCDGLCQVCGUNGM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze anisole;1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1-phenoxyethanol?
The IUPAC name of anisole;1-phenoxyethanol (CID 143208941) is anisole;1-phenoxyethanol.
What is the SMILES notation for anisole;1-phenoxyethanol?
The canonical SMILES for anisole;1-phenoxyethanol is CC(O)Oc1ccccc1.COc1ccccc1.
What is the InChIKey of anisole;1-phenoxyethanol?
The InChIKey is LCDGLCQVCGUNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C7H8O/c1-7(9)10-8-5-3-2-4-6-8;1-8-7-5-3-2-4-6-7/h2-7,9H,1H3;2-6H,1H3.
What are the key properties of anisole;1-phenoxyethanol?
anisole;1-phenoxyethanol has a molecular weight of 246.31 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1-phenoxyethanol is sourced from PubChem (CID 143208941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).