About azane;aziridin-2-ol;1-phenoxyethanol
azane;aziridin-2-ol;1-phenoxyethanol (PubChem CID 20544565) has the molecular formula C10H18N2O3
and a molecular weight of 214.27 g/mol. Its IUPAC name is azane;aziridin-2-ol;1-phenoxyethanol.
Molecular Properties
| Compound Name | azane;aziridin-2-ol;1-phenoxyethanol |
| PubChem CID | 20544565 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | azane;aziridin-2-ol;1-phenoxyethanol |
| SMILES | CC(O)Oc1ccccc1.N.OC1CN1 |
| InChI | InChI=1S/C8H10O2.C2H5NO.H3N/c1-7(9)10-8-5-3-2-4-6-8;4-2-1-3-2;/h2-7,9H,1H3;2-4H,1H2;1H3 |
| InChIKey | RMBQWQYPLMRHOF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;aziridin-2-ol;1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;aziridin-2-ol;1-phenoxyethanol?
The IUPAC name of azane;aziridin-2-ol;1-phenoxyethanol (CID 20544565) is azane;aziridin-2-ol;1-phenoxyethanol.
What is the SMILES notation for azane;aziridin-2-ol;1-phenoxyethanol?
The canonical SMILES for azane;aziridin-2-ol;1-phenoxyethanol is CC(O)Oc1ccccc1.N.OC1CN1.
What is the InChIKey of azane;aziridin-2-ol;1-phenoxyethanol?
The InChIKey is RMBQWQYPLMRHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C2H5NO.H3N/c1-7(9)10-8-5-3-2-4-6-8;4-2-1-3-2;/h2-7,9H,1H3;2-4H,1H2;1H3.
What are the key properties of azane;aziridin-2-ol;1-phenoxyethanol?
azane;aziridin-2-ol;1-phenoxyethanol has a molecular weight of 214.27 g/mol, XLogP of 0.47, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;aziridin-2-ol;1-phenoxyethanol is sourced from PubChem (CID 20544565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).