C28H27NO4 — CID 71095144
1-[4-(N-[4-(1-hydroxyethoxy)phenyl]-4-phenylanilino)phenoxy]ethanol (PubChem CID 71095144) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[4-(N-[4-(1-hydroxyethoxy)phenyl]-4-phenylanilino)phenoxy]ethanol.
| Compound Name | 1-[4-(N-[4-(1-hydroxyethoxy)phenyl]-4-phenylanilino)phenoxy]ethanol |
|---|---|
| PubChem CID | 71095144 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[4-(N-[4-(1-hydroxyethoxy)phenyl]-4-phenylanilino)phenoxy]ethanol |
| SMILES | CC(O)Oc1ccc(N(c2ccc(OC(C)O)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H27NO4/c1-20(30)32-27-16-12-25(13-17-27)29(26-14-18-28(19-15-26)33-21(2)31)24-10-8-23(9-11-24)22-6-4-3-5-7-22/h3-21,30-31H,1-2H3 |
| InChIKey | KUAFGVDAIIJRPO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|