C36H27BNO2 — CID 158332419
CID 158332419 (PubChem CID 158332419) has the molecular formula C36H27BNO2 and a molecular weight of 516.43 g/mol.
| Compound Name | CID 158332419 |
|---|---|
| PubChem CID | 158332419 |
| Molecular Formula | C36H27BNO2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H27BNO2/c39-37-40-36-25-17-32(18-26-36)31-15-23-35(24-16-31)38(33-19-11-29(12-20-33)27-7-3-1-4-8-27)34-21-13-30(14-22-34)28-9-5-2-6-10-28/h1-26,39H |
| InChIKey | DPQAJXPDLUUHMO-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|