About CID 170776711
CID 170776711 (PubChem CID 170776711) has the molecular formula C36H27BNO2
and a molecular weight of 516.43 g/mol.
Molecular Properties
| Compound Name | CID 170776711 |
| PubChem CID | 170776711 |
| Molecular Formula | C36H27BNO2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C36H27BNO2/c39-37-40-34-24-25-36(35(26-34)31-14-8-3-9-15-31)38(32-20-16-29(17-21-32)27-10-4-1-5-11-27)33-22-18-30(19-23-33)28-12-6-2-7-13-28/h1-26,39H |
| InChIKey | WZIBVYLYHWYTOY-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170776711 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170776711?
The IUPAC name of CID 170776711 (CID 170776711) is not available.
What is the SMILES notation for CID 170776711?
The canonical SMILES for CID 170776711 is O[B]Oc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c(-c2ccccc2)c1.
What is the InChIKey of CID 170776711?
The InChIKey is WZIBVYLYHWYTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27BNO2/c39-37-40-34-24-25-36(35(26-34)31-14-8-3-9-15-31)38(32-20-16-29(17-21-32)27-10-4-1-5-11-27)33-22-18-30(19-23-33)28-12-6-2-7-13-28/h1-26,39H.
What are the key properties of CID 170776711?
CID 170776711 has a molecular weight of 516.43 g/mol, XLogP of 9.06, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170776711 is sourced from PubChem (CID 170776711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).