C24H19BNO2 — CID 89461197
CID 89461197 (PubChem CID 89461197) has the molecular formula C24H19BNO2 and a molecular weight of 364.23 g/mol.
| Compound Name | CID 89461197 |
|---|---|
| PubChem CID | 89461197 |
| Molecular Formula | C24H19BNO2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H19BNO2/c27-25-28-24-17-15-23(16-18-24)26(21-9-5-2-6-10-21)22-13-11-20(12-14-22)19-7-3-1-4-8-19/h1-18,27H |
| InChIKey | QRORUFQWNHSZBQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|