C42H40N2O4 — CID 71095176
1-[4-[4-[4-[4-(1-hydroxyethoxy)-N-(3-methylphenyl)anilino]phenyl]-N-(3-methylphenyl)anilino]phenoxy]ethanol (PubChem CID 71095176) has the molecular formula C42H40N2O4 and a molecular weight of 636.79 g/mol. Its IUPAC name is 1-[4-[4-[4-[4-(1-hydroxyethoxy)-N-(3-methylphenyl)anilino]phenyl]-N-(3-methylphenyl)anilino]phenoxy]ethanol.
| Compound Name | 1-[4-[4-[4-[4-(1-hydroxyethoxy)-N-(3-methylphenyl)anilino]phenyl]-N-(3-methylphenyl)anilino]phenoxy]ethanol |
|---|---|
| PubChem CID | 71095176 |
| Molecular Formula | C42H40N2O4 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | 1-[4-[4-[4-[4-(1-hydroxyethoxy)-N-(3-methylphenyl)anilino]phenyl]-N-(3-methylphenyl)anilino]phenoxy]ethanol |
| SMILES | Cc1cccc(N(c2ccc(OC(C)O)cc2)c2ccc(-c3ccc(N(c4ccc(OC(C)O)cc4)c4cccc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C42H40N2O4/c1-29-7-5-9-39(27-29)43(37-19-23-41(24-20-37)47-31(3)45)35-15-11-33(12-16-35)34-13-17-36(18-14-34)44(40-10-6-8-30(2)28-40)38-21-25-42(26-22-38)48-32(4)46/h5-28,31-32,45-46H,1-4H3 |
| InChIKey | XZFFYOCTPPUPBY-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|