C43H42N2O2 — CID 59561163
2,2-dimethyl-1-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenoxy]butan-1-ol (PubChem CID 59561163) has the molecular formula C43H42N2O2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenoxy]butan-1-ol.
| Compound Name | 2,2-dimethyl-1-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 59561163 |
| Molecular Formula | C43H42N2O2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 2,2-dimethyl-1-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenoxy]butan-1-ol |
| SMILES | CCC(C)(C)C(O)Oc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(C)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H42N2O2/c1-5-43(3,4)42(46)47-41-29-27-39(28-30-41)44(35-14-8-6-9-15-35)37-23-19-33(20-24-37)34-21-25-38(26-22-34)45(36-16-10-7-11-17-36)40-18-12-13-32(2)31-40/h6-31,42,46H,5H2,1-4H3 |
| InChIKey | FBSXHAIKPVCTJZ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|