About 1-phenoxyethanol;trihydrate
1-phenoxyethanol;trihydrate (PubChem CID 175915128) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-phenoxyethanol;trihydrate.
Molecular Properties
| Compound Name | 1-phenoxyethanol;trihydrate |
| PubChem CID | 175915128 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-phenoxyethanol;trihydrate |
| SMILES | CC(O)Oc1ccccc1.O.O.O |
| InChI | InChI=1S/C8H10O2.3H2O/c1-7(9)10-8-5-3-2-4-6-8;;;/h2-7,9H,1H3;3*1H2 |
| InChIKey | WUZSWUFODZGACN-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyethanol;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyethanol;trihydrate?
The IUPAC name of 1-phenoxyethanol;trihydrate (CID 175915128) is 1-phenoxyethanol;trihydrate.
What is the SMILES notation for 1-phenoxyethanol;trihydrate?
The canonical SMILES for 1-phenoxyethanol;trihydrate is CC(O)Oc1ccccc1.O.O.O.
What is the InChIKey of 1-phenoxyethanol;trihydrate?
The InChIKey is WUZSWUFODZGACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.3H2O/c1-7(9)10-8-5-3-2-4-6-8;;;/h2-7,9H,1H3;3*1H2.
What are the key properties of 1-phenoxyethanol;trihydrate?
1-phenoxyethanol;trihydrate has a molecular weight of 192.21 g/mol, XLogP of -1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyethanol;trihydrate is sourced from PubChem (CID 175915128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).