About 1-phenoxyethanesulfonyl chloride
1-phenoxyethanesulfonyl chloride (PubChem CID 18351740) has the molecular formula C8H9ClO3S
and a molecular weight of 220.68 g/mol. Its IUPAC name is 1-phenoxyethanesulfonyl chloride.
Molecular Properties
| Compound Name | 1-phenoxyethanesulfonyl chloride |
| PubChem CID | 18351740 |
| Molecular Formula | C8H9ClO3S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 1-phenoxyethanesulfonyl chloride |
| SMILES | CC(Oc1ccccc1)S(=O)(=O)Cl |
| InChI | InChI=1S/C8H9ClO3S/c1-7(13(9,10)11)12-8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | AIJHPHDOGXZKFW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenoxyethanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyethanesulfonyl chloride?
The IUPAC name of 1-phenoxyethanesulfonyl chloride (CID 18351740) is 1-phenoxyethanesulfonyl chloride.
What is the SMILES notation for 1-phenoxyethanesulfonyl chloride?
The canonical SMILES for 1-phenoxyethanesulfonyl chloride is CC(Oc1ccccc1)S(=O)(=O)Cl.
What is the InChIKey of 1-phenoxyethanesulfonyl chloride?
The InChIKey is AIJHPHDOGXZKFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO3S/c1-7(13(9,10)11)12-8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-phenoxyethanesulfonyl chloride?
1-phenoxyethanesulfonyl chloride has a molecular weight of 220.68 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyethanesulfonyl chloride is sourced from PubChem (CID 18351740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).