About 1,2-dichloropropoxybenzene
1,2-dichloropropoxybenzene (PubChem CID 118151210) has the molecular formula C9H10Cl2O
and a molecular weight of 205.08 g/mol. Its IUPAC name is 1,2-dichloropropoxybenzene.
Molecular Properties
| Compound Name | 1,2-dichloropropoxybenzene |
| PubChem CID | 118151210 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 1,2-dichloropropoxybenzene |
| SMILES | CC(Cl)C(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C9H10Cl2O/c1-7(10)9(11)12-8-5-3-2-4-6-8/h2-7,9H,1H3 |
| InChIKey | CTIZPSNFOUNOHG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloropropoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloropropoxybenzene?
The IUPAC name of 1,2-dichloropropoxybenzene (CID 118151210) is 1,2-dichloropropoxybenzene.
What is the SMILES notation for 1,2-dichloropropoxybenzene?
The canonical SMILES for 1,2-dichloropropoxybenzene is CC(Cl)C(Cl)Oc1ccccc1.
What is the InChIKey of 1,2-dichloropropoxybenzene?
The InChIKey is CTIZPSNFOUNOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O/c1-7(10)9(11)12-8-5-3-2-4-6-8/h2-7,9H,1H3.
What are the key properties of 1,2-dichloropropoxybenzene?
1,2-dichloropropoxybenzene has a molecular weight of 205.08 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloropropoxybenzene is sourced from PubChem (CID 118151210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).