About propan-2-yl formate;propan-2-yloxybenzene
propan-2-yl formate;propan-2-yloxybenzene (PubChem CID 175545424) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is propan-2-yl formate;propan-2-yloxybenzene.
Molecular Properties
| Compound Name | propan-2-yl formate;propan-2-yloxybenzene |
| PubChem CID | 175545424 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | propan-2-yl formate;propan-2-yloxybenzene |
| SMILES | CC(C)OC=O.CC(C)Oc1ccccc1 |
| InChI | InChI=1S/C9H12O.C4H8O2/c1-8(2)10-9-6-4-3-5-7-9;1-4(2)6-3-5/h3-8H,1-2H3;3-4H,1-2H3 |
| InChIKey | CIVYJXYLVZJQQC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl formate;propan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl formate;propan-2-yloxybenzene?
The IUPAC name of propan-2-yl formate;propan-2-yloxybenzene (CID 175545424) is propan-2-yl formate;propan-2-yloxybenzene.
What is the SMILES notation for propan-2-yl formate;propan-2-yloxybenzene?
The canonical SMILES for propan-2-yl formate;propan-2-yloxybenzene is CC(C)OC=O.CC(C)Oc1ccccc1.
What is the InChIKey of propan-2-yl formate;propan-2-yloxybenzene?
The InChIKey is CIVYJXYLVZJQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C4H8O2/c1-8(2)10-9-6-4-3-5-7-9;1-4(2)6-3-5/h3-8H,1-2H3;3-4H,1-2H3.
What are the key properties of propan-2-yl formate;propan-2-yloxybenzene?
propan-2-yl formate;propan-2-yloxybenzene has a molecular weight of 224.30 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl formate;propan-2-yloxybenzene is sourced from PubChem (CID 175545424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).