About 2-phenoxypropanedial
2-phenoxypropanedial (PubChem CID 54237008) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-phenoxypropanedial.
Molecular Properties
| Compound Name | 2-phenoxypropanedial |
| PubChem CID | 54237008 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-phenoxypropanedial |
| SMILES | O=CC(C=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H8O3/c10-6-9(7-11)12-8-4-2-1-3-5-8/h1-7,9H |
| InChIKey | UZJYPVJTBGAXFJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxypropanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxypropanedial?
The IUPAC name of 2-phenoxypropanedial (CID 54237008) is 2-phenoxypropanedial.
What is the SMILES notation for 2-phenoxypropanedial?
The canonical SMILES for 2-phenoxypropanedial is O=CC(C=O)Oc1ccccc1.
What is the InChIKey of 2-phenoxypropanedial?
The InChIKey is UZJYPVJTBGAXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-6-9(7-11)12-8-4-2-1-3-5-8/h1-7,9H.
What are the key properties of 2-phenoxypropanedial?
2-phenoxypropanedial has a molecular weight of 164.16 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxypropanedial is sourced from PubChem (CID 54237008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).