C28H34O5S — CID 154513847
1-(7-phenoxyheptoxy)-4-(4-propan-2-yloxyphenyl)sulfonylbenzene (PubChem CID 154513847) has the molecular formula C28H34O5S and a molecular weight of 482.64 g/mol. Its IUPAC name is 1-(7-phenoxyheptoxy)-4-(4-propan-2-yloxyphenyl)sulfonylbenzene.
| Compound Name | 1-(7-phenoxyheptoxy)-4-(4-propan-2-yloxyphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 154513847 |
| Molecular Formula | C28H34O5S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-(7-phenoxyheptoxy)-4-(4-propan-2-yloxyphenyl)sulfonylbenzene |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)c2ccc(OCCCCCCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H34O5S/c1-23(2)33-26-15-19-28(20-16-26)34(29,30)27-17-13-25(14-18-27)32-22-10-5-3-4-9-21-31-24-11-7-6-8-12-24/h6-8,11-20,23H,3-5,9-10,21-22H2,1-2H3 |
| InChIKey | GMBGNTKZOAJGBH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|