C48H42O8S2 — CID 139826992
1,2-bis[[4-[4-(1-phenylethoxy)phenyl]sulfonylphenoxy]methyl]benzene (PubChem CID 139826992) has the molecular formula C48H42O8S2 and a molecular weight of 810.99 g/mol. Its IUPAC name is 1,2-bis[[4-[4-(1-phenylethoxy)phenyl]sulfonylphenoxy]methyl]benzene.
| Compound Name | 1,2-bis[[4-[4-(1-phenylethoxy)phenyl]sulfonylphenoxy]methyl]benzene |
|---|---|
| PubChem CID | 139826992 |
| Molecular Formula | C48H42O8S2 |
| Molecular Weight | 810.99 g/mol |
| Exact Mass | 810.23 |
| IUPAC Name | 1,2-bis[[4-[4-(1-phenylethoxy)phenyl]sulfonylphenoxy]methyl]benzene |
| SMILES | CC(Oc1ccc(S(=O)(=O)c2ccc(OCc3ccccc3COc3ccc(S(=O)(=O)c4ccc(OC(C)c5ccccc5)cc4)cc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C48H42O8S2/c1-35(37-11-5-3-6-12-37)55-43-21-29-47(30-22-43)57(49,50)45-25-17-41(18-26-45)53-33-39-15-9-10-16-40(39)34-54-42-19-27-46(28-20-42)58(51,52)48-31-23-44(24-32-48)56-36(2)38-13-7-4-8-14-38/h3-32,35-36H,33-34H2,1-2H3 |
| InChIKey | JVDPBYCEDIASAY-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.99 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |