C23H33NO3S — CID 19759163
N-[3-[4-(benzenesulfonyl)phenoxy]propyl]-N-butylbutan-1-amine (PubChem CID 19759163) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-[3-[4-(benzenesulfonyl)phenoxy]propyl]-N-butylbutan-1-amine.
| Compound Name | N-[3-[4-(benzenesulfonyl)phenoxy]propyl]-N-butylbutan-1-amine |
|---|---|
| PubChem CID | 19759163 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | N-[3-[4-(benzenesulfonyl)phenoxy]propyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H33NO3S/c1-3-5-17-24(18-6-4-2)19-10-20-27-21-13-15-23(16-14-21)28(25,26)22-11-8-7-9-12-22/h7-9,11-16H,3-6,10,17-20H2,1-2H3 |
| InChIKey | KHJGSRUAOZXXTA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|