C35H47ClN2O4S — CID 67807729
N-butyl-N-[3-[4-[6-[(2-propan-2-ylphenyl)methoxy]indolizin-1-yl]sulfonylphenoxy]propyl]butan-1-amine;hydrochloride (PubChem CID 67807729) has the molecular formula C35H47ClN2O4S and a molecular weight of 627.29 g/mol. Its IUPAC name is N-butyl-N-[3-[4-[6-[(2-propan-2-ylphenyl)methoxy]indolizin-1-yl]sulfonylphenoxy]propyl]butan-1-amine;hydrochloride.
| Compound Name | N-butyl-N-[3-[4-[6-[(2-propan-2-ylphenyl)methoxy]indolizin-1-yl]sulfonylphenoxy]propyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67807729 |
| Molecular Formula | C35H47ClN2O4S |
| Molecular Weight | 627.29 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | N-butyl-N-[3-[4-[6-[(2-propan-2-ylphenyl)methoxy]indolizin-1-yl]sulfonylphenoxy]propyl]butan-1-amine;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2ccn3cc(OCc4ccccc4C(C)C)ccc23)cc1.Cl |
| InChI | InChI=1S/C35H46N2O4S.ClH/c1-5-7-21-36(22-8-6-2)23-11-25-40-30-14-17-32(18-15-30)42(38,39)35-20-24-37-26-31(16-19-34(35)37)41-27-29-12-9-10-13-33(29)28(3)4;/h9-10,12-20,24,26,28H,5-8,11,21-23,25,27H2,1-4H3;1H |
| InChIKey | BQKSXTNGPSTVBQ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.29 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|